C13H22 — CID 90943443
1-ethenyl-1,2,3-trimethyl-5-propan-2-ylidenecyclopentane (PubChem CID 90943443) has the molecular formula C13H22 and a molecular weight of 178.32 g/mol. Its IUPAC name is 1-ethenyl-1,2,3-trimethyl-5-propan-2-ylidenecyclopentane.
| Compound Name | 1-ethenyl-1,2,3-trimethyl-5-propan-2-ylidenecyclopentane |
|---|---|
| PubChem CID | 90943443 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | 1-ethenyl-1,2,3-trimethyl-5-propan-2-ylidenecyclopentane |
| SMILES | C=CC1(C)C(=C(C)C)CC(C)C1C |
| InChI | InChI=1S/C13H22/c1-7-13(6)11(5)10(4)8-12(13)9(2)3/h7,10-11H,1,8H2,2-6H3 |
| InChIKey | DOCBBNQTUZWZNH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|