C45H36F6N2O10 — CID 90950946
[4-(2,2,2-trifluoroethoxy)phenyl] 4-[5-(2,4-diaminophenyl)-6,6-dihydroxy-3,7-dioxo-9-[4-[4-(2,2,2-trifluoroethoxy)phenoxy]carbonylphenyl]nona-1,8-dienyl]benzoate (PubChem CID 90950946) has the molecular formula C45H36F6N2O10 and a molecular weight of 878.77 g/mol. Its IUPAC name is [4-(2,2,2-trifluoroethoxy)phenyl] 4-[5-(2,4-diaminophenyl)-6,6-dihydroxy-3,7-dioxo-9-[4-[4-(2,2,2-trifluoroethoxy)phenoxy]carbonylphenyl]nona-1,8-dienyl]benzoate.
| Compound Name | [4-(2,2,2-trifluoroethoxy)phenyl] 4-[5-(2,4-diaminophenyl)-6,6-dihydroxy-3,7-dioxo-9-[4-[4-(2,2,2-trifluoroethoxy)phenoxy]carbonylphenyl]nona-1,8-dienyl]benzoate |
|---|---|
| PubChem CID | 90950946 |
| Molecular Formula | C45H36F6N2O10 |
| Molecular Weight | 878.77 g/mol |
| Exact Mass | 878.23 |
| IUPAC Name | [4-(2,2,2-trifluoroethoxy)phenyl] 4-[5-(2,4-diaminophenyl)-6,6-dihydroxy-3,7-dioxo-9-[4-[4-(2,2,2-trifluoroethoxy)phenoxy]carbonylphenyl]nona-1,8-dienyl]benzoate |
| SMILES | Nc1ccc(C(CC(=O)C=Cc2ccc(C(=O)Oc3ccc(OCC(F)(F)F)cc3)cc2)C(O)(O)C(=O)C=Cc2ccc(C(=O)Oc3ccc(OCC(F)(F)F)cc3)cc2)c(N)c1 |
| InChI | InChI=1S/C45H36F6N2O10/c46-43(47,48)25-60-33-13-17-35(18-14-33)62-41(56)29-7-1-27(2-8-29)5-12-32(54)24-38(37-21-11-31(52)23-39(37)53)45(58,59)40(55)22-6-28-3-9-30(10-4-28)42(57)63-36-19-15-34(16-20-36)61-26-44(49,50)51/h1-23,38,58-59H,24-26,52-53H2 |
| InChIKey | BZMLUEIBMSAMQV-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 197.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.77 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|