C55H78N2O8 — CID 68612900
(1E,8E)-5-(2,4-diaminophenyl)-1,9-bis[4-[(4-heptoxycyclohexyl)methoxy]phenyl]-4,4-dihydroxynona-1,8-diene-3,7-dione (PubChem CID 68612900) has the molecular formula C55H78N2O8 and a molecular weight of 895.24 g/mol. Its IUPAC name is (1E,8E)-5-(2,4-diaminophenyl)-1,9-bis[4-[(4-heptoxycyclohexyl)methoxy]phenyl]-4,4-dihydroxynona-1,8-diene-3,7-dione.
| Compound Name | (1E,8E)-5-(2,4-diaminophenyl)-1,9-bis[4-[(4-heptoxycyclohexyl)methoxy]phenyl]-4,4-dihydroxynona-1,8-diene-3,7-dione |
|---|---|
| PubChem CID | 68612900 |
| Molecular Formula | C55H78N2O8 |
| Molecular Weight | 895.24 g/mol |
| Exact Mass | 894.58 |
| IUPAC Name | (1E,8E)-5-(2,4-diaminophenyl)-1,9-bis[4-[(4-heptoxycyclohexyl)methoxy]phenyl]-4,4-dihydroxynona-1,8-diene-3,7-dione |
| SMILES | CCCCCCCOC1CCC(COc2ccc(/C=C/C(=O)CC(c3ccc(N)cc3N)C(O)(O)C(=O)/C=C/c3ccc(OCC4CCC(OCCCCCCC)CC4)cc3)cc2)CC1 |
| InChI | InChI=1S/C55H78N2O8/c1-3-5-7-9-11-35-62-47-29-18-43(19-30-47)39-64-49-25-14-41(15-26-49)13-24-46(58)38-52(51-33-23-45(56)37-53(51)57)55(60,61)54(59)34-22-42-16-27-50(28-17-42)65-40-44-20-31-48(32-21-44)63-36-12-10-8-6-4-2/h13-17,22-28,33-34,37,43-44,47-48,52,60-61H,3-12,18-21,29-32,35-36,38-40,56-57H2,1-2H3/b24-13+,34-22+ |
| InChIKey | OIUOGCANCKJFMV-BTJJFATFSA-N |
| XLogP | 11.42 |
| TPSA | 163.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.24 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|