C63H86N2O6 — CID 91536996
5,5-bis[(4-aminophenyl)methyl]-1,9-bis[4-[(4-heptylcyclohexyl)methoxy]phenyl]-4,4-dihydroxynona-1,8-diene-3,7-dione (PubChem CID 91536996) has the molecular formula C63H86N2O6 and a molecular weight of 967.39 g/mol. Its IUPAC name is 5,5-bis[(4-aminophenyl)methyl]-1,9-bis[4-[(4-heptylcyclohexyl)methoxy]phenyl]-4,4-dihydroxynona-1,8-diene-3,7-dione.
| Compound Name | 5,5-bis[(4-aminophenyl)methyl]-1,9-bis[4-[(4-heptylcyclohexyl)methoxy]phenyl]-4,4-dihydroxynona-1,8-diene-3,7-dione |
|---|---|
| PubChem CID | 91536996 |
| Molecular Formula | C63H86N2O6 |
| Molecular Weight | 967.39 g/mol |
| Exact Mass | 966.65 |
| IUPAC Name | 5,5-bis[(4-aminophenyl)methyl]-1,9-bis[4-[(4-heptylcyclohexyl)methoxy]phenyl]-4,4-dihydroxynona-1,8-diene-3,7-dione |
| SMILES | CCCCCCCC1CCC(COc2ccc(C=CC(=O)CC(Cc3ccc(N)cc3)(Cc3ccc(N)cc3)C(O)(O)C(=O)C=Cc3ccc(OCC4CCC(CCCCCCC)CC4)cc3)cc2)CC1 |
| InChI | InChI=1S/C63H86N2O6/c1-3-5-7-9-11-13-48-15-19-54(20-16-48)46-70-59-38-28-50(29-39-59)27-37-58(66)45-62(43-52-23-33-56(64)34-24-52,44-53-25-35-57(65)36-26-53)63(68,69)61(67)42-32-51-30-40-60(41-31-51)71-47-55-21-17-49(18-22-55)14-12-10-8-6-4-2/h23-42,48-49,54-55,68-69H,3-22,43-47,64-65H2,1-2H3 |
| InChIKey | JCWHHXVKPFQZED-UHFFFAOYSA-N |
| XLogP | 14.35 |
| TPSA | 145.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 967.39 |
| LogP ≤ 5 | 14.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|