C57H82N2O6 — CID 68614133
(1E,8E)-5-(2,4-diaminophenyl)-4,6-dihydroxy-1,9-bis[4-[(4-octylcyclohexyl)methoxy]phenyl]nona-1,8-diene-3,7-dione (PubChem CID 68614133) has the molecular formula C57H82N2O6 and a molecular weight of 891.29 g/mol. Its IUPAC name is (1E,8E)-5-(2,4-diaminophenyl)-4,6-dihydroxy-1,9-bis[4-[(4-octylcyclohexyl)methoxy]phenyl]nona-1,8-diene-3,7-dione.
| Compound Name | (1E,8E)-5-(2,4-diaminophenyl)-4,6-dihydroxy-1,9-bis[4-[(4-octylcyclohexyl)methoxy]phenyl]nona-1,8-diene-3,7-dione |
|---|---|
| PubChem CID | 68614133 |
| Molecular Formula | C57H82N2O6 |
| Molecular Weight | 891.29 g/mol |
| Exact Mass | 890.62 |
| IUPAC Name | (1E,8E)-5-(2,4-diaminophenyl)-4,6-dihydroxy-1,9-bis[4-[(4-octylcyclohexyl)methoxy]phenyl]nona-1,8-diene-3,7-dione |
| SMILES | CCCCCCCCC1CCC(COc2ccc(/C=C/C(=O)C(O)C(c3ccc(N)cc3N)C(O)C(=O)/C=C/c3ccc(OCC4CCC(CCCCCCCC)CC4)cc3)cc2)CC1 |
| InChI | InChI=1S/C57H82N2O6/c1-3-5-7-9-11-13-15-42-17-21-46(22-18-42)40-64-49-32-25-44(26-33-49)29-37-53(60)56(62)55(51-36-31-48(58)39-52(51)59)57(63)54(61)38-30-45-27-34-50(35-28-45)65-41-47-23-19-43(20-24-47)16-14-12-10-8-6-4-2/h25-39,42-43,46-47,55-57,62-63H,3-24,40-41,58-59H2,1-2H3/b37-29+,38-30+ |
| InChIKey | QIDCQQMENOZGSS-UDEUAJILSA-N |
| XLogP | 13.09 |
| TPSA | 145.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.29 |
| LogP ≤ 5 | 13.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|