C47H58N2O8 — CID 68613551
5-(2,4-diaminophenyl)-4,4-dihydroxy-1,9-bis[4-[(4-prop-2-enoxycyclohexyl)methoxy]phenyl]nona-1,8-diene-3,7-dione (PubChem CID 68613551) has the molecular formula C47H58N2O8 and a molecular weight of 778.99 g/mol. Its IUPAC name is 5-(2,4-diaminophenyl)-4,4-dihydroxy-1,9-bis[4-[(4-prop-2-enoxycyclohexyl)methoxy]phenyl]nona-1,8-diene-3,7-dione.
| Compound Name | 5-(2,4-diaminophenyl)-4,4-dihydroxy-1,9-bis[4-[(4-prop-2-enoxycyclohexyl)methoxy]phenyl]nona-1,8-diene-3,7-dione |
|---|---|
| PubChem CID | 68613551 |
| Molecular Formula | C47H58N2O8 |
| Molecular Weight | 778.99 g/mol |
| Exact Mass | 778.42 |
| IUPAC Name | 5-(2,4-diaminophenyl)-4,4-dihydroxy-1,9-bis[4-[(4-prop-2-enoxycyclohexyl)methoxy]phenyl]nona-1,8-diene-3,7-dione |
| SMILES | C=CCOC1CCC(COc2ccc(C=CC(=O)CC(c3ccc(N)cc3N)C(O)(O)C(=O)C=Cc3ccc(OCC4CCC(OCC=C)CC4)cc3)cc2)CC1 |
| InChI | InChI=1S/C47H58N2O8/c1-3-27-54-39-21-10-35(11-22-39)31-56-41-17-6-33(7-18-41)5-16-38(50)30-44(43-25-15-37(48)29-45(43)49)47(52,53)46(51)26-14-34-8-19-42(20-9-34)57-32-36-12-23-40(24-13-36)55-28-4-2/h3-9,14-20,25-26,29,35-36,39-40,44,52-53H,1-2,10-13,21-24,27-28,30-32,48-49H2 |
| InChIKey | KDEGWSUILYUGNX-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 163.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.99 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|