C18H19ClN2S — CID 90951620
N-[2-[4-(1-chloroethyl)phenyl]ethyl]-3-methylthieno[2,3-b]pyridin-4-amine (PubChem CID 90951620) has the molecular formula C18H19ClN2S and a molecular weight of 330.88 g/mol. Its IUPAC name is N-[2-[4-(1-chloroethyl)phenyl]ethyl]-3-methylthieno[2,3-b]pyridin-4-amine.
| Compound Name | N-[2-[4-(1-chloroethyl)phenyl]ethyl]-3-methylthieno[2,3-b]pyridin-4-amine |
|---|---|
| PubChem CID | 90951620 |
| Molecular Formula | C18H19ClN2S |
| Molecular Weight | 330.88 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | N-[2-[4-(1-chloroethyl)phenyl]ethyl]-3-methylthieno[2,3-b]pyridin-4-amine |
| SMILES | Cc1csc2nccc(NCCc3ccc(C(C)Cl)cc3)c12 |
| InChI | InChI=1S/C18H19ClN2S/c1-12-11-22-18-17(12)16(8-10-21-18)20-9-7-14-3-5-15(6-4-14)13(2)19/h3-6,8,10-11,13H,7,9H2,1-2H3,(H,20,21) |
| InChIKey | POJPLCCAELJRAY-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.88 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|