C14H19ClN4O2S — CID 9095178
1-(2-chloro-5-nitrophenyl)-3-(1-ethylpiperidin-4-yl)thiourea (PubChem CID 9095178) has the molecular formula C14H19ClN4O2S and a molecular weight of 342.85 g/mol. Its IUPAC name is 1-(2-chloro-5-nitrophenyl)-3-(1-ethylpiperidin-4-yl)thiourea.
| Compound Name | 1-(2-chloro-5-nitrophenyl)-3-(1-ethylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 9095178 |
| Molecular Formula | C14H19ClN4O2S |
| Molecular Weight | 342.85 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 1-(2-chloro-5-nitrophenyl)-3-(1-ethylpiperidin-4-yl)thiourea |
| SMILES | CCN1CCC(NC(=S)Nc2cc([N+](=O)[O-])ccc2Cl)CC1 |
| InChI | InChI=1S/C14H19ClN4O2S/c1-2-18-7-5-10(6-8-18)16-14(22)17-13-9-11(19(20)21)3-4-12(13)15/h3-4,9-10H,2,5-8H2,1H3,(H2,16,17,22) |
| InChIKey | XLSDAVDONHNZSW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 70.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.85 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|