C31H49NO11 — CID 90951996
(2R,3S,4S)-2-amino-2-[[3,4-bis(pentan-2-yloxycarbonyloxy)phenyl]methyl]-3-methyl-4-(2-methylbutan-2-yloxycarbonyloxy)pentanoic acid (PubChem CID 90951996) has the molecular formula C31H49NO11 and a molecular weight of 611.73 g/mol. Its IUPAC name is (2R,3S,4S)-2-amino-2-[[3,4-bis(pentan-2-yloxycarbonyloxy)phenyl]methyl]-3-methyl-4-(2-methylbutan-2-yloxycarbonyloxy)pentanoic acid.
| Compound Name | (2R,3S,4S)-2-amino-2-[[3,4-bis(pentan-2-yloxycarbonyloxy)phenyl]methyl]-3-methyl-4-(2-methylbutan-2-yloxycarbonyloxy)pentanoic acid |
|---|---|
| PubChem CID | 90951996 |
| Molecular Formula | C31H49NO11 |
| Molecular Weight | 611.73 g/mol |
| Exact Mass | 611.33 |
| IUPAC Name | (2R,3S,4S)-2-amino-2-[[3,4-bis(pentan-2-yloxycarbonyloxy)phenyl]methyl]-3-methyl-4-(2-methylbutan-2-yloxycarbonyloxy)pentanoic acid |
| SMILES | CCCC(C)OC(=O)Oc1ccc(C[C@](N)(C(=O)O)[C@H](C)[C@H](C)OC(=O)OC(C)(C)CC)cc1OC(=O)OC(C)CCC |
| InChI | InChI=1S/C31H49NO11/c1-10-13-19(4)38-27(35)41-24-16-15-23(17-25(24)42-28(36)39-20(5)14-11-2)18-31(32,26(33)34)21(6)22(7)40-29(37)43-30(8,9)12-3/h15-17,19-22H,10-14,18,32H2,1-9H3,(H,33,34)/t19?,20?,21-,22+,31-/m1/s1 |
| InChIKey | NQKGFPQVACNSFY-VOOLPEHCSA-N |
| XLogP | 6.79 |
| TPSA | 169.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.73 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|