C32H49NO11 — CID 91596018
(2R,3S,4S)-2-amino-2-[[3,4-bis(2-methylbutoxycarbonyloxy)phenyl]methyl]-4-cyclohexyloxycarbonyloxy-3-methylpentanoic acid (PubChem CID 91596018) has the molecular formula C32H49NO11 and a molecular weight of 623.74 g/mol. Its IUPAC name is (2R,3S,4S)-2-amino-2-[[3,4-bis(2-methylbutoxycarbonyloxy)phenyl]methyl]-4-cyclohexyloxycarbonyloxy-3-methylpentanoic acid.
| Compound Name | (2R,3S,4S)-2-amino-2-[[3,4-bis(2-methylbutoxycarbonyloxy)phenyl]methyl]-4-cyclohexyloxycarbonyloxy-3-methylpentanoic acid |
|---|---|
| PubChem CID | 91596018 |
| Molecular Formula | C32H49NO11 |
| Molecular Weight | 623.74 g/mol |
| Exact Mass | 623.33 |
| IUPAC Name | (2R,3S,4S)-2-amino-2-[[3,4-bis(2-methylbutoxycarbonyloxy)phenyl]methyl]-4-cyclohexyloxycarbonyloxy-3-methylpentanoic acid |
| SMILES | CCC(C)COC(=O)Oc1ccc(C[C@](N)(C(=O)O)[C@H](C)[C@H](C)OC(=O)OC2CCCCC2)cc1OC(=O)OCC(C)CC |
| InChI | InChI=1S/C32H49NO11/c1-7-20(3)18-39-29(36)43-26-15-14-24(16-27(26)44-30(37)40-19-21(4)8-2)17-32(33,28(34)35)22(5)23(6)41-31(38)42-25-12-10-9-11-13-25/h14-16,20-23,25H,7-13,17-19,33H2,1-6H3,(H,34,35)/t20?,21?,22-,23+,32-/m1/s1 |
| InChIKey | LUFGZYYQBNFQAP-OZIBFBAUSA-N |
| XLogP | 6.64 |
| TPSA | 169.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.74 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|