C31H49NO10 — CID 91253491
(2R,3S,4S)-2-amino-2-[[3,4-bis(2-methylbutan-2-yloxycarbonyloxy)phenyl]methyl]-4-hexanoyloxy-3-methylpentanoic acid (PubChem CID 91253491) has the molecular formula C31H49NO10 and a molecular weight of 595.73 g/mol. Its IUPAC name is (2R,3S,4S)-2-amino-2-[[3,4-bis(2-methylbutan-2-yloxycarbonyloxy)phenyl]methyl]-4-hexanoyloxy-3-methylpentanoic acid.
| Compound Name | (2R,3S,4S)-2-amino-2-[[3,4-bis(2-methylbutan-2-yloxycarbonyloxy)phenyl]methyl]-4-hexanoyloxy-3-methylpentanoic acid |
|---|---|
| PubChem CID | 91253491 |
| Molecular Formula | C31H49NO10 |
| Molecular Weight | 595.73 g/mol |
| Exact Mass | 595.34 |
| IUPAC Name | (2R,3S,4S)-2-amino-2-[[3,4-bis(2-methylbutan-2-yloxycarbonyloxy)phenyl]methyl]-4-hexanoyloxy-3-methylpentanoic acid |
| SMILES | CCCCCC(=O)O[C@@H](C)[C@@H](C)[C@](N)(Cc1ccc(OC(=O)OC(C)(C)CC)c(OC(=O)OC(C)(C)CC)c1)C(=O)O |
| InChI | InChI=1S/C31H49NO10/c1-10-13-14-15-25(33)38-21(5)20(4)31(32,26(34)35)19-22-16-17-23(39-27(36)41-29(6,7)11-2)24(18-22)40-28(37)42-30(8,9)12-3/h16-18,20-21H,10-15,19,32H2,1-9H3,(H,34,35)/t20-,21+,31-/m1/s1 |
| InChIKey | GKFGJUCQRDTQFW-HSNRCERBSA-N |
| XLogP | 6.57 |
| TPSA | 160.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.73 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|