C29H45NO8 — CID 91573458
(2R,3S,4S)-2-amino-2-[[3,4-bis(2-methylbutanoyloxy)phenyl]methyl]-4-hexanoyloxy-3-methylpentanoic acid (PubChem CID 91573458) has the molecular formula C29H45NO8 and a molecular weight of 535.68 g/mol. Its IUPAC name is (2R,3S,4S)-2-amino-2-[[3,4-bis(2-methylbutanoyloxy)phenyl]methyl]-4-hexanoyloxy-3-methylpentanoic acid.
| Compound Name | (2R,3S,4S)-2-amino-2-[[3,4-bis(2-methylbutanoyloxy)phenyl]methyl]-4-hexanoyloxy-3-methylpentanoic acid |
|---|---|
| PubChem CID | 91573458 |
| Molecular Formula | C29H45NO8 |
| Molecular Weight | 535.68 g/mol |
| Exact Mass | 535.31 |
| IUPAC Name | (2R,3S,4S)-2-amino-2-[[3,4-bis(2-methylbutanoyloxy)phenyl]methyl]-4-hexanoyloxy-3-methylpentanoic acid |
| SMILES | CCCCCC(=O)O[C@@H](C)[C@@H](C)[C@](N)(Cc1ccc(OC(=O)C(C)CC)c(OC(=O)C(C)CC)c1)C(=O)O |
| InChI | InChI=1S/C29H45NO8/c1-8-11-12-13-25(31)36-21(7)20(6)29(30,28(34)35)17-22-14-15-23(37-26(32)18(4)9-2)24(16-22)38-27(33)19(5)10-3/h14-16,18-21H,8-13,17,30H2,1-7H3,(H,34,35)/t18?,19?,20-,21+,29-/m1/s1 |
| InChIKey | FEAFVTJBHWDMOX-DAGFOSOPSA-N |
| XLogP | 5.06 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.68 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|