C5H7NO2 — CID 90952935
2-hydroxy-2,3-dihydro-1H-pyridin-6-one (PubChem CID 90952935) has the molecular formula C5H7NO2 and a molecular weight of 113.12 g/mol. Its IUPAC name is 2-hydroxy-2,3-dihydro-1H-pyridin-6-one.
| Compound Name | 2-hydroxy-2,3-dihydro-1H-pyridin-6-one |
|---|---|
| PubChem CID | 90952935 |
| Molecular Formula | C5H7NO2 |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.05 |
| IUPAC Name | 2-hydroxy-2,3-dihydro-1H-pyridin-6-one |
| SMILES | O=C1C=CCC(O)N1 |
| InChI | InChI=1S/C5H7NO2/c7-4-2-1-3-5(8)6-4/h1-2,5,8H,3H2,(H,6,7) |
| InChIKey | OXFSUUDQBOMMBA-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |