C8H15NO2 — CID 59032704
(Z)-5-hydroxy-N-propylpent-2-enamide (PubChem CID 59032704) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is (Z)-5-hydroxy-N-propylpent-2-enamide.
| Compound Name | (Z)-5-hydroxy-N-propylpent-2-enamide |
|---|---|
| PubChem CID | 59032704 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | (Z)-5-hydroxy-N-propylpent-2-enamide |
| SMILES | CCCNC(=O)/C=C\CCO |
| InChI | InChI=1S/C8H15NO2/c1-2-6-9-8(11)5-3-4-7-10/h3,5,10H,2,4,6-7H2,1H3,(H,9,11)/b5-3- |
| InChIKey | AZJSGDGQJFYWGG-HYXAFXHYSA-N |
| XLogP | 0.45 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|