C32H31ClN2O4S — CID 90953688
6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-(1-phenylbenzimidazol-2-yl)sulfanyloxane-2,4-dione (PubChem CID 90953688) has the molecular formula C32H31ClN2O4S and a molecular weight of 575.13 g/mol. Its IUPAC name is 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-(1-phenylbenzimidazol-2-yl)sulfanyloxane-2,4-dione.
| Compound Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-(1-phenylbenzimidazol-2-yl)sulfanyloxane-2,4-dione |
|---|---|
| PubChem CID | 90953688 |
| Molecular Formula | C32H31ClN2O4S |
| Molecular Weight | 575.13 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-(1-phenylbenzimidazol-2-yl)sulfanyloxane-2,4-dione |
| SMILES | COc1ccc(CCC2(C3CCCC3)CC(=O)C(Sc3nc4ccccc4n3-c3ccccc3)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C32H31ClN2O4S/c1-38-28-16-15-21(19-24(28)33)17-18-32(22-9-5-6-10-22)20-27(36)29(30(37)39-32)40-31-34-25-13-7-8-14-26(25)35(31)23-11-3-2-4-12-23/h2-4,7-8,11-16,19,22,29H,5-6,9-10,17-18,20H2,1H3 |
| InChIKey | WWIRFCPAELSFRR-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.13 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|