C20H18ClF3N2O3 — CID 90953838
7-chloro-5-morpholin-4-yl-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol (PubChem CID 90953838) has the molecular formula C20H18ClF3N2O3 and a molecular weight of 426.82 g/mol. Its IUPAC name is 7-chloro-5-morpholin-4-yl-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol.
| Compound Name | 7-chloro-5-morpholin-4-yl-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol |
|---|---|
| PubChem CID | 90953838 |
| Molecular Formula | C20H18ClF3N2O3 |
| Molecular Weight | 426.82 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 7-chloro-5-morpholin-4-yl-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol |
| SMILES | Oc1c2c(Cl)cc(N3CCOCC3)cc2cn1Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H18ClF3N2O3/c21-17-10-15(25-5-7-28-8-6-25)9-14-12-26(19(27)18(14)17)11-13-1-3-16(4-2-13)29-20(22,23)24/h1-4,9-10,12,27H,5-8,11H2 |
| InChIKey | WGYKAPBPMRKOCP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 46.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.82 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |