C8H15NO3S — CID 90955315
2-amino-3-ethylidenehex-4-ene-1-sulfonic acid (PubChem CID 90955315) has the molecular formula C8H15NO3S and a molecular weight of 205.28 g/mol. Its IUPAC name is 2-amino-3-ethylidenehex-4-ene-1-sulfonic acid.
| Compound Name | 2-amino-3-ethylidenehex-4-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 90955315 |
| Molecular Formula | C8H15NO3S |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | 2-amino-3-ethylidenehex-4-ene-1-sulfonic acid |
| SMILES | CC=CC(=CC)C(N)CS(=O)(=O)O |
| InChI | InChI=1S/C8H15NO3S/c1-3-5-7(4-2)8(9)6-13(10,11)12/h3-5,8H,6,9H2,1-2H3,(H,10,11,12) |
| InChIKey | CITZZPSJYQADPC-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|