C25H24ClN3O7 — CID 90958753
(4aS,5aR,12aS)-9-(5-chloro-1H-pyrrol-2-yl)-7-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90958753) has the molecular formula C25H24ClN3O7 and a molecular weight of 513.93 g/mol. Its IUPAC name is (4aS,5aR,12aS)-9-(5-chloro-1H-pyrrol-2-yl)-7-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-9-(5-chloro-1H-pyrrol-2-yl)-7-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90958753 |
| Molecular Formula | C25H24ClN3O7 |
| Molecular Weight | 513.93 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | (4aS,5aR,12aS)-9-(5-chloro-1H-pyrrol-2-yl)-7-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc(-c2ccc(Cl)[nH]2)c(O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C25H24ClN3O7/c1-29(2)14-8-11(13-3-4-16(26)28-13)20(31)18-12(14)6-9-5-10-7-15(30)19(24(27)35)23(34)25(10,36)22(33)17(9)21(18)32/h3-4,8-10,17,19,28,31,36H,5-7H2,1-2H3,(H2,27,35)/t9-,10+,17?,19?,25+/m1/s1 |
| InChIKey | BTSBGCZEUIORBK-QAVUGLOASA-N |
| XLogP | 1.04 |
| TPSA | 170.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.93 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|