C23H19ClN2O7 — CID 90923574
(4aS,5aR,12aS)-7-(5-chloro-1H-pyrrol-2-yl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90923574) has the molecular formula C23H19ClN2O7 and a molecular weight of 470.87 g/mol. Its IUPAC name is (4aS,5aR,12aS)-7-(5-chloro-1H-pyrrol-2-yl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-7-(5-chloro-1H-pyrrol-2-yl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90923574 |
| Molecular Formula | C23H19ClN2O7 |
| Molecular Weight | 470.87 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | (4aS,5aR,12aS)-7-(5-chloro-1H-pyrrol-2-yl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | NC(=O)C1C(=O)C[C@@H]2C[C@@H]3Cc4c(-c5ccc(Cl)[nH]5)ccc(O)c4C(=O)C3C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C23H19ClN2O7/c24-15-4-2-12(26-15)10-1-3-13(27)17-11(10)6-8-5-9-7-14(28)18(22(25)32)21(31)23(9,33)20(30)16(8)19(17)29/h1-4,8-9,16,18,26-27,33H,5-7H2,(H2,25,32)/t8-,9+,16?,18?,23+/m1/s1 |
| InChIKey | MHERCAGTKOABKR-OSQFQNJUSA-N |
| XLogP | 0.98 |
| TPSA | 167.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.87 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|