C26H26N2O7 — CID 91213078
(4aS,5aR,12aS)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-propan-2-yl-9-(1H-pyrrol-2-yl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91213078) has the molecular formula C26H26N2O7 and a molecular weight of 478.50 g/mol. Its IUPAC name is (4aS,5aR,12aS)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-propan-2-yl-9-(1H-pyrrol-2-yl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-propan-2-yl-9-(1H-pyrrol-2-yl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91213078 |
| Molecular Formula | C26H26N2O7 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | (4aS,5aR,12aS)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-propan-2-yl-9-(1H-pyrrol-2-yl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(C)c1cc(-c2ccc[nH]2)c(O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C26H26N2O7/c1-10(2)13-9-15(16-4-3-5-28-16)21(30)19-14(13)7-11-6-12-8-17(29)20(25(27)34)24(33)26(12,35)23(32)18(11)22(19)31/h3-5,9-12,18,20,28,30,35H,6-8H2,1-2H3,(H2,27,34)/t11-,12+,18?,20?,26+/m1/s1 |
| InChIKey | MKZDBLGEQXNSTB-ABKHKTOWSA-N |
| XLogP | 1.45 |
| TPSA | 167.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|