About CID 90961754
CID 90961754 (PubChem CID 90961754) has the molecular formula C16H20O3S2
and a molecular weight of 326.48 g/mol.
Molecular Properties
| Compound Name | CID 90961754 |
| PubChem CID | 90961754 |
| Molecular Formula | C16H20O3S2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | — |
| SMILES | COc1cc(C)c(SS(=O)(=O)c2ccc(C)cc2)cc1C.[2H][2H] |
| InChI | InChI=1S/C16H18O3S2.H2/c1-11-5-7-14(8-6-11)21(17,18)20-16-10-12(2)15(19-4)9-13(16)3;/h5-10H,1-4H3;1H/i;1+1D |
| InChIKey | OOHLDHJFJVWKDD-PJFXLBAMSA-N |
| XLogP | 4.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze CID 90961754 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90961754?
The IUPAC name of CID 90961754 (CID 90961754) is not available.
What is the SMILES notation for CID 90961754?
The canonical SMILES for CID 90961754 is COc1cc(C)c(SS(=O)(=O)c2ccc(C)cc2)cc1C.[2H][2H].
What is the InChIKey of CID 90961754?
The InChIKey is OOHLDHJFJVWKDD-PJFXLBAMSA-N. The full InChI is InChI=1S/C16H18O3S2.H2/c1-11-5-7-14(8-6-11)21(17,18)20-16-10-12(2)15(19-4)9-13(16)3;/h5-10H,1-4H3;1H/i;1+1D.
What are the key properties of CID 90961754?
CID 90961754 has a molecular weight of 326.48 g/mol, XLogP of 4.35, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90961754 is sourced from PubChem (CID 90961754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).