C20H27F2NO3S — CID 90961939
(5R)-5-[(3S)-4-(3,4-difluorophenyl)-3-hydroxybut-1-enyl]-1-[2-(4-hydroxybutylsulfanyl)ethyl]pyrrolidin-2-one (PubChem CID 90961939) has the molecular formula C20H27F2NO3S and a molecular weight of 399.50 g/mol. Its IUPAC name is (5R)-5-[(3S)-4-(3,4-difluorophenyl)-3-hydroxybut-1-enyl]-1-[2-(4-hydroxybutylsulfanyl)ethyl]pyrrolidin-2-one.
| Compound Name | (5R)-5-[(3S)-4-(3,4-difluorophenyl)-3-hydroxybut-1-enyl]-1-[2-(4-hydroxybutylsulfanyl)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 90961939 |
| Molecular Formula | C20H27F2NO3S |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | (5R)-5-[(3S)-4-(3,4-difluorophenyl)-3-hydroxybut-1-enyl]-1-[2-(4-hydroxybutylsulfanyl)ethyl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@H](C=C[C@@H](O)Cc2ccc(F)c(F)c2)N1CCSCCCCO |
| InChI | InChI=1S/C20H27F2NO3S/c21-18-7-3-15(14-19(18)22)13-17(25)6-4-16-5-8-20(26)23(16)9-12-27-11-2-1-10-24/h3-4,6-7,14,16-17,24-25H,1-2,5,8-13H2/t16-,17+/m0/s1 |
| InChIKey | XARICLBAUWEXGV-DLBZAZTESA-N |
| XLogP | 2.92 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|