C20H18BrFO5 — CID 90962548
3-[(2R,3R,4R,5R)-3-benzoyloxy-5-bromo-4-fluoro-4-methyloxolan-2-yl]-2-methylbenzoic acid (PubChem CID 90962548) has the molecular formula C20H18BrFO5 and a molecular weight of 437.26 g/mol. Its IUPAC name is 3-[(2R,3R,4R,5R)-3-benzoyloxy-5-bromo-4-fluoro-4-methyloxolan-2-yl]-2-methylbenzoic acid.
| Compound Name | 3-[(2R,3R,4R,5R)-3-benzoyloxy-5-bromo-4-fluoro-4-methyloxolan-2-yl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 90962548 |
| Molecular Formula | C20H18BrFO5 |
| Molecular Weight | 437.26 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | 3-[(2R,3R,4R,5R)-3-benzoyloxy-5-bromo-4-fluoro-4-methyloxolan-2-yl]-2-methylbenzoic acid |
| SMILES | Cc1c(C(=O)O)cccc1[C@H]1O[C@H](Br)[C@](C)(F)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H18BrFO5/c1-11-13(9-6-10-14(11)17(23)24)15-16(20(2,22)19(21)26-15)27-18(25)12-7-4-3-5-8-12/h3-10,15-16,19H,1-2H3,(H,23,24)/t15-,16-,19+,20-/m1/s1 |
| InChIKey | RKYJEPSUFVWBCJ-YAJHFMINSA-N |
| XLogP | 4.44 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.26 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|