C29H31N5O2S2 — CID 90965275
5-(1,3-benzothiazol-2-yl)-6-methyl-4-N-spiro[7,9-dioxatricyclo[4.3.0.01,3]nonane-8,1'-cyclohexane]-6-yl-2-N-(thiophen-2-ylmethyl)pyrimidine-2,4-diamine (PubChem CID 90965275) has the molecular formula C29H31N5O2S2 and a molecular weight of 545.73 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-6-methyl-4-N-spiro[7,9-dioxatricyclo[4.3.0.01,3]nonane-8,1'-cyclohexane]-6-yl-2-N-(thiophen-2-ylmethyl)pyrimidine-2,4-diamine.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-6-methyl-4-N-spiro[7,9-dioxatricyclo[4.3.0.01,3]nonane-8,1'-cyclohexane]-6-yl-2-N-(thiophen-2-ylmethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 90965275 |
| Molecular Formula | C29H31N5O2S2 |
| Molecular Weight | 545.73 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-6-methyl-4-N-spiro[7,9-dioxatricyclo[4.3.0.01,3]nonane-8,1'-cyclohexane]-6-yl-2-N-(thiophen-2-ylmethyl)pyrimidine-2,4-diamine |
| SMILES | Cc1nc(NCc2cccs2)nc(NC23CCC4CC42OC2(CCCCC2)O3)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C29H31N5O2S2/c1-18-23(25-32-21-9-3-4-10-22(21)38-25)24(33-26(31-18)30-17-20-8-7-15-37-20)34-29-14-11-19-16-28(19,29)35-27(36-29)12-5-2-6-13-27/h3-4,7-10,15,19H,2,5-6,11-14,16-17H2,1H3,(H2,30,31,33,34) |
| InChIKey | CANHRQLGKXZXIW-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.73 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |