About CID 90965406
CID 90965406 (PubChem CID 90965406) has the molecular formula C25H25FN4O2
and a molecular weight of 432.50 g/mol.
Molecular Properties
| Compound Name | CID 90965406 |
| PubChem CID | 90965406 |
| Molecular Formula | C25H25FN4O2 |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | — |
| SMILES | Cc1cc(F)cc(-c2ccc3c(c2)C2(N=C(N)N(C)O2)C2(CCc4onc(C)c4C2)C3)c1 |
| InChI | InChI=1S/C25H25FN4O2/c1-14-8-18(10-19(26)9-14)16-4-5-17-12-24(7-6-22-20(13-24)15(2)29-31-22)25(21(17)11-16)28-23(27)30(3)32-25/h4-5,8-11H,6-7,12-13H2,1-3H3,(H2,27,28) |
| InChIKey | XRKZFMXASVHLAY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 90965406 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90965406?
The IUPAC name of CID 90965406 (CID 90965406) is not available.
What is the SMILES notation for CID 90965406?
The canonical SMILES for CID 90965406 is Cc1cc(F)cc(-c2ccc3c(c2)C2(N=C(N)N(C)O2)C2(CCc4onc(C)c4C2)C3)c1.
What is the InChIKey of CID 90965406?
The InChIKey is XRKZFMXASVHLAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25FN4O2/c1-14-8-18(10-19(26)9-14)16-4-5-17-12-24(7-6-22-20(13-24)15(2)29-31-22)25(21(17)11-16)28-23(27)30(3)32-25/h4-5,8-11H,6-7,12-13H2,1-3H3,(H2,27,28).
What are the key properties of CID 90965406?
CID 90965406 has a molecular weight of 432.50 g/mol, XLogP of 4.17, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90965406 is sourced from PubChem (CID 90965406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).