C21H30O2 — CID 90966173
6-(1-ethylcyclohexyl)tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid (PubChem CID 90966173) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is 6-(1-ethylcyclohexyl)tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid.
| Compound Name | 6-(1-ethylcyclohexyl)tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid |
|---|---|
| PubChem CID | 90966173 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 6-(1-ethylcyclohexyl)tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid |
| SMILES | CCC1(C23CC(C(=O)O)C(C2)C2C4C=CC(C4)C23)CCCCC1 |
| InChI | InChI=1S/C21H30O2/c1-2-20(8-4-3-5-9-20)21-11-15(16(12-21)19(22)23)17-13-6-7-14(10-13)18(17)21/h6-7,13-18H,2-5,8-12H2,1H3,(H,22,23) |
| InChIKey | JVYCYDDNWJCNDV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|