C20H33Br — CID 90966230
9-bromo-10-cyclohexyl-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene (PubChem CID 90966230) has the molecular formula C20H33Br and a molecular weight of 353.39 g/mol. Its IUPAC name is 9-bromo-10-cyclohexyl-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene.
| Compound Name | 9-bromo-10-cyclohexyl-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene |
|---|---|
| PubChem CID | 90966230 |
| Molecular Formula | C20H33Br |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 9-bromo-10-cyclohexyl-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene |
| SMILES | BrC1C2CCCCC2C(C2CCCCC2)C2CCCCC12 |
| InChI | InChI=1S/C20H33Br/c21-20-17-12-6-4-10-15(17)19(14-8-2-1-3-9-14)16-11-5-7-13-18(16)20/h14-20H,1-13H2 |
| InChIKey | PXTSJCFBZQQKDE-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|