About [2-(2-iminoacetyl)phenyl] 2-nitrobenzenesulfonate
[2-(2-iminoacetyl)phenyl] 2-nitrobenzenesulfonate (PubChem CID 90969790) has the molecular formula C14H10N2O6S
and a molecular weight of 334.31 g/mol. Its IUPAC name is [2-(2-iminoacetyl)phenyl] 2-nitrobenzenesulfonate.
Molecular Properties
| Compound Name | [2-(2-iminoacetyl)phenyl] 2-nitrobenzenesulfonate |
| PubChem CID | 90969790 |
| Molecular Formula | C14H10N2O6S |
| Molecular Weight | 334.31 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | [2-(2-iminoacetyl)phenyl] 2-nitrobenzenesulfonate |
| SMILES | [H]/N=C/C(=O)c1ccccc1OS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H10N2O6S/c15-9-12(17)10-5-1-3-7-13(10)22-23(20,21)14-8-4-2-6-11(14)16(18)19/h1-9,15H/b15-9+ |
| InChIKey | DEHOWVCPHWLDNU-OQLLNIDSSA-N |
| XLogP | 2.19 |
| TPSA | 127.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-iminoacetyl)phenyl] 2-nitrobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-iminoacetyl)phenyl] 2-nitrobenzenesulfonate?
The IUPAC name of [2-(2-iminoacetyl)phenyl] 2-nitrobenzenesulfonate (CID 90969790) is [2-(2-iminoacetyl)phenyl] 2-nitrobenzenesulfonate.
What is the SMILES notation for [2-(2-iminoacetyl)phenyl] 2-nitrobenzenesulfonate?
The canonical SMILES for [2-(2-iminoacetyl)phenyl] 2-nitrobenzenesulfonate is [H]/N=C/C(=O)c1ccccc1OS(=O)(=O)c1ccccc1[N+](=O)[O-].
What is the InChIKey of [2-(2-iminoacetyl)phenyl] 2-nitrobenzenesulfonate?
The InChIKey is DEHOWVCPHWLDNU-OQLLNIDSSA-N. The full InChI is InChI=1S/C14H10N2O6S/c15-9-12(17)10-5-1-3-7-13(10)22-23(20,21)14-8-4-2-6-11(14)16(18)19/h1-9,15H/b15-9+.
What are the key properties of [2-(2-iminoacetyl)phenyl] 2-nitrobenzenesulfonate?
[2-(2-iminoacetyl)phenyl] 2-nitrobenzenesulfonate has a molecular weight of 334.31 g/mol, XLogP of 2.19, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-iminoacetyl)phenyl] 2-nitrobenzenesulfonate is sourced from PubChem (CID 90969790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).