C7H14NO2+ — CID 90970433
5-methylidene-2-propyl-1,3,5-dioxazinan-5-ium (PubChem CID 90970433) has the molecular formula C7H14NO2+ and a molecular weight of 144.19 g/mol. Its IUPAC name is 5-methylidene-2-propyl-1,3,5-dioxazinan-5-ium.
| Compound Name | 5-methylidene-2-propyl-1,3,5-dioxazinan-5-ium |
|---|---|
| PubChem CID | 90970433 |
| Molecular Formula | C7H14NO2+ |
| Molecular Weight | 144.19 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | 5-methylidene-2-propyl-1,3,5-dioxazinan-5-ium |
| SMILES | C=[N+]1COC(CCC)OC1 |
| InChI | InChI=1S/C7H14NO2/c1-3-4-7-9-5-8(2)6-10-7/h7H,2-6H2,1H3/q+1 |
| InChIKey | SOIDHHJYCAUFIO-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.19 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|