C9H12K2O6 — CID 168866248
dipotassium;2-propyl-1,3-dioxane-5,5-dicarboxylate (PubChem CID 168866248) has the molecular formula C9H12K2O6 and a molecular weight of 294.38 g/mol. Its IUPAC name is dipotassium;2-propyl-1,3-dioxane-5,5-dicarboxylate.
| Compound Name | dipotassium;2-propyl-1,3-dioxane-5,5-dicarboxylate |
|---|---|
| PubChem CID | 168866248 |
| Molecular Formula | C9H12K2O6 |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 293.99 |
| IUPAC Name | dipotassium;2-propyl-1,3-dioxane-5,5-dicarboxylate |
| SMILES | CCCC1OCC(C(=O)[O-])(C(=O)[O-])CO1.[K+].[K+] |
| InChI | InChI=1S/C9H14O6.2K/c1-2-3-6-14-4-9(5-15-6,7(10)11)8(12)13;;/h6H,2-5H2,1H3,(H,10,11)(H,12,13);;/q;2*+1/p-2 |
| InChIKey | RDLFIYZITCIUPB-UHFFFAOYSA-L |
| XLogP | -8.35 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | -8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|