About dipotassium;2-propyl-1,3-dioxane-5,5-dicarboxylate
dipotassium;2-propyl-1,3-dioxane-5,5-dicarboxylate (PubChem CID 168866248) has the molecular formula C9H12K2O6
and a molecular weight of 294.38 g/mol. Its IUPAC name is dipotassium;2-propyl-1,3-dioxane-5,5-dicarboxylate.
Molecular Properties
| Compound Name | dipotassium;2-propyl-1,3-dioxane-5,5-dicarboxylate |
| PubChem CID | 168866248 |
| Molecular Formula | C9H12K2O6 |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 293.99 |
| IUPAC Name | dipotassium;2-propyl-1,3-dioxane-5,5-dicarboxylate |
| SMILES | CCCC1OCC(C(=O)[O-])(C(=O)[O-])CO1.[K+].[K+] |
| InChI | InChI=1S/C9H14O6.2K/c1-2-3-6-14-4-9(5-15-6,7(10)11)8(12)13;;/h6H,2-5H2,1H3,(H,10,11)(H,12,13);;/q;2*+1/p-2 |
| InChIKey | RDLFIYZITCIUPB-UHFFFAOYSA-L |
| XLogP | -8.35 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | -8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;2-propyl-1,3-dioxane-5,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;2-propyl-1,3-dioxane-5,5-dicarboxylate?
The IUPAC name of dipotassium;2-propyl-1,3-dioxane-5,5-dicarboxylate (CID 168866248) is dipotassium;2-propyl-1,3-dioxane-5,5-dicarboxylate.
What is the SMILES notation for dipotassium;2-propyl-1,3-dioxane-5,5-dicarboxylate?
The canonical SMILES for dipotassium;2-propyl-1,3-dioxane-5,5-dicarboxylate is CCCC1OCC(C(=O)[O-])(C(=O)[O-])CO1.[K+].[K+].
What is the InChIKey of dipotassium;2-propyl-1,3-dioxane-5,5-dicarboxylate?
The InChIKey is RDLFIYZITCIUPB-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H14O6.2K/c1-2-3-6-14-4-9(5-15-6,7(10)11)8(12)13;;/h6H,2-5H2,1H3,(H,10,11)(H,12,13);;/q;2*+1/p-2.
What are the key properties of dipotassium;2-propyl-1,3-dioxane-5,5-dicarboxylate?
dipotassium;2-propyl-1,3-dioxane-5,5-dicarboxylate has a molecular weight of 294.38 g/mol, XLogP of -8.35, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;2-propyl-1,3-dioxane-5,5-dicarboxylate is sourced from PubChem (CID 168866248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).