C17H21NO5 — CID 18611692
(4-ethoxyphenyl) 5-cyano-2-propyl-1,3-dioxane-5-carboxylate (PubChem CID 18611692) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is (4-ethoxyphenyl) 5-cyano-2-propyl-1,3-dioxane-5-carboxylate.
| Compound Name | (4-ethoxyphenyl) 5-cyano-2-propyl-1,3-dioxane-5-carboxylate |
|---|---|
| PubChem CID | 18611692 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (4-ethoxyphenyl) 5-cyano-2-propyl-1,3-dioxane-5-carboxylate |
| SMILES | CCCC1OCC(C#N)(C(=O)Oc2ccc(OCC)cc2)CO1 |
| InChI | InChI=1S/C17H21NO5/c1-3-5-15-21-11-17(10-18,12-22-15)16(19)23-14-8-6-13(7-9-14)20-4-2/h6-9,15H,3-5,11-12H2,1-2H3 |
| InChIKey | JYSUQDPVIABQAJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|