C20H34O4-2 — CID 58183374
3,4,5,6-tetrapropylcyclohexane-1,2-dicarboxylate (PubChem CID 58183374) has the molecular formula C20H34O4-2 and a molecular weight of 338.49 g/mol. Its IUPAC name is 3,4,5,6-tetrapropylcyclohexane-1,2-dicarboxylate.
| Compound Name | 3,4,5,6-tetrapropylcyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 58183374 |
| Molecular Formula | C20H34O4-2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 3,4,5,6-tetrapropylcyclohexane-1,2-dicarboxylate |
| SMILES | CCCC1C(CCC)C(CCC)C(C(=O)[O-])C(C(=O)[O-])C1CCC |
| InChI | InChI=1S/C20H36O4/c1-5-9-13-14(10-6-2)16(12-8-4)18(20(23)24)17(19(21)22)15(13)11-7-3/h13-18H,5-12H2,1-4H3,(H,21,22)(H,23,24)/p-2 |
| InChIKey | AFXBQGGWZYDHOQ-UHFFFAOYSA-L |
| XLogP | 2.40 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |