C21H26N6O2S — CID 90971948
4-N-benzyl-5-(1,3-dioxol-4-yl)-1-N-(3-imidazol-1-yl-1,2,4-thiadiazol-5-yl)-4-methylpentane-1,4-diamine (PubChem CID 90971948) has the molecular formula C21H26N6O2S and a molecular weight of 426.55 g/mol. Its IUPAC name is 4-N-benzyl-5-(1,3-dioxol-4-yl)-1-N-(3-imidazol-1-yl-1,2,4-thiadiazol-5-yl)-4-methylpentane-1,4-diamine.
| Compound Name | 4-N-benzyl-5-(1,3-dioxol-4-yl)-1-N-(3-imidazol-1-yl-1,2,4-thiadiazol-5-yl)-4-methylpentane-1,4-diamine |
|---|---|
| PubChem CID | 90971948 |
| Molecular Formula | C21H26N6O2S |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 4-N-benzyl-5-(1,3-dioxol-4-yl)-1-N-(3-imidazol-1-yl-1,2,4-thiadiazol-5-yl)-4-methylpentane-1,4-diamine |
| SMILES | CC(CCCNc1nc(-n2ccnc2)ns1)(CC1=COCO1)NCc1ccccc1 |
| InChI | InChI=1S/C21H26N6O2S/c1-21(12-18-14-28-16-29-18,24-13-17-6-3-2-4-7-17)8-5-9-23-20-25-19(26-30-20)27-11-10-22-15-27/h2-4,6-7,10-11,14-15,24H,5,8-9,12-13,16H2,1H3,(H,23,25,26) |
| InChIKey | ZYXCLTGRXIFETE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 86.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|