C20H21NO2 — CID 90972350
1-butyl-3,4-diphenylpyrrole-2,5-diol (PubChem CID 90972350) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is 1-butyl-3,4-diphenylpyrrole-2,5-diol.
| Compound Name | 1-butyl-3,4-diphenylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 90972350 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 1-butyl-3,4-diphenylpyrrole-2,5-diol |
| SMILES | CCCCn1c(O)c(-c2ccccc2)c(-c2ccccc2)c1O |
| InChI | InChI=1S/C20H21NO2/c1-2-3-14-21-19(22)17(15-10-6-4-7-11-15)18(20(21)23)16-12-8-5-9-13-16/h4-13,22-23H,2-3,14H2,1H3 |
| InChIKey | VXTCMSMRLMWRPE-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |