C21H26O4 — CID 90972733
2-[(8R,9S,10R,13S,14S)-17-formyl-3-hydroxy-13-methyl-3,8,9,10,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-4-yl]acetic acid (PubChem CID 90972733) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-[(8R,9S,10R,13S,14S)-17-formyl-3-hydroxy-13-methyl-3,8,9,10,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-4-yl]acetic acid.
| Compound Name | 2-[(8R,9S,10R,13S,14S)-17-formyl-3-hydroxy-13-methyl-3,8,9,10,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-4-yl]acetic acid |
|---|---|
| PubChem CID | 90972733 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 2-[(8R,9S,10R,13S,14S)-17-formyl-3-hydroxy-13-methyl-3,8,9,10,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-4-yl]acetic acid |
| SMILES | C[C@]12CC[C@H]3[C@@H](C=CC4=C(CC(=O)O)C(O)C=C[C@@H]43)[C@@H]1CCC2C=O |
| InChI | InChI=1S/C21H26O4/c1-21-9-8-15-13-5-7-19(23)17(10-20(24)25)14(13)3-4-16(15)18(21)6-2-12(21)11-22/h3-5,7,11-13,15-16,18-19,23H,2,6,8-10H2,1H3,(H,24,25)/t12?,13-,15+,16+,18-,19?,21+/m0/s1 |
| InChIKey | CVWXXRJKHHJDGB-ORZPGIKZSA-N |
| XLogP | 3.13 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|