C22H26O4 — CID 91239642
2-[(8S,9S,10R,13S,14S)-17-formyl-10,13-dimethyl-3-oxo-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-4-yl]acetic acid (PubChem CID 91239642) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-[(8S,9S,10R,13S,14S)-17-formyl-10,13-dimethyl-3-oxo-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-4-yl]acetic acid.
| Compound Name | 2-[(8S,9S,10R,13S,14S)-17-formyl-10,13-dimethyl-3-oxo-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-4-yl]acetic acid |
|---|---|
| PubChem CID | 91239642 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 2-[(8S,9S,10R,13S,14S)-17-formyl-10,13-dimethyl-3-oxo-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-4-yl]acetic acid |
| SMILES | C[C@]12C=CC(=O)C(CC(=O)O)=C1C=C[C@@H]1[C@@H]2CC[C@]2(C)C(C=O)CC[C@@H]12 |
| InChI | InChI=1S/C22H26O4/c1-21-9-7-18-14(16(21)5-3-13(21)12-23)4-6-17-15(11-20(25)26)19(24)8-10-22(17,18)2/h4,6,8,10,12-14,16,18H,3,5,7,9,11H2,1-2H3,(H,25,26)/t13?,14-,16-,18-,21+,22-/m0/s1 |
| InChIKey | VHIXDEGXFWZJRH-YHZCMUHYSA-N |
| XLogP | 3.73 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|