C21H28O3 — CID 67189608
2-[(8R,9S,10R,13S,14S,17R)-17-methoxy-13-methyl-3,8,9,10,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-4-yl]acetic acid (PubChem CID 67189608) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is 2-[(8R,9S,10R,13S,14S,17R)-17-methoxy-13-methyl-3,8,9,10,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-4-yl]acetic acid.
| Compound Name | 2-[(8R,9S,10R,13S,14S,17R)-17-methoxy-13-methyl-3,8,9,10,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-4-yl]acetic acid |
|---|---|
| PubChem CID | 67189608 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 2-[(8R,9S,10R,13S,14S,17R)-17-methoxy-13-methyl-3,8,9,10,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-4-yl]acetic acid |
| SMILES | CO[C@@H]1CC[C@H]2[C@@H]3C=CC4=C(CC(=O)O)CC=C[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H28O3/c1-21-11-10-16-15-5-3-4-13(12-20(22)23)14(15)6-7-17(16)18(21)8-9-19(21)24-2/h3,5-7,15-19H,4,8-12H2,1-2H3,(H,22,23)/t15-,16+,17+,18-,19+,21-/m0/s1 |
| InChIKey | KTLOWIWBQXUIDC-PLYBDPPMSA-N |
| XLogP | 4.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|