C20H26O3 — CID 67190269
2-[(8R,9S,10R,13S,14S)-3-hydroxy-13-methyl-3,8,9,10,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-4-yl]acetic acid (PubChem CID 67190269) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is 2-[(8R,9S,10R,13S,14S)-3-hydroxy-13-methyl-3,8,9,10,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-4-yl]acetic acid.
| Compound Name | 2-[(8R,9S,10R,13S,14S)-3-hydroxy-13-methyl-3,8,9,10,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-4-yl]acetic acid |
|---|---|
| PubChem CID | 67190269 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 2-[(8R,9S,10R,13S,14S)-3-hydroxy-13-methyl-3,8,9,10,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-4-yl]acetic acid |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1C=CC3=C(CC(=O)O)C(O)C=C[C@@H]3[C@H]1CC2 |
| InChI | InChI=1S/C20H26O3/c1-20-9-2-3-17(20)15-5-4-13-12(14(15)8-10-20)6-7-18(21)16(13)11-19(22)23/h4-7,12,14-15,17-18,21H,2-3,8-11H2,1H3,(H,22,23)/t12-,14+,15+,17-,18?,20-/m0/s1 |
| InChIKey | XXGABYWCGRQFLD-OBFFICITSA-N |
| XLogP | 3.71 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|