C21H31NO2 — CID 174312314
(8S,9S,10R,13S,14S,17S)-4-amino-17-(hydroxymethyl)-10,13-dimethyl-2,3,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3-carbaldehyde (PubChem CID 174312314) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17S)-4-amino-17-(hydroxymethyl)-10,13-dimethyl-2,3,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3-carbaldehyde.
| Compound Name | (8S,9S,10R,13S,14S,17S)-4-amino-17-(hydroxymethyl)-10,13-dimethyl-2,3,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3-carbaldehyde |
|---|---|
| PubChem CID | 174312314 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | (8S,9S,10R,13S,14S,17S)-4-amino-17-(hydroxymethyl)-10,13-dimethyl-2,3,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3-carbaldehyde |
| SMILES | C[C@]12CC[C@H]3[C@@H](C=CC4=C(N)C(C=O)CC[C@@]43C)[C@@H]1CC[C@@H]2CO |
| InChI | InChI=1S/C21H31NO2/c1-20-10-8-17-15(16(20)5-3-14(20)12-24)4-6-18-19(22)13(11-23)7-9-21(17,18)2/h4,6,11,13-17,24H,3,5,7-10,12,22H2,1-2H3/t13?,14-,15+,16+,17+,20-,21-/m1/s1 |
| InChIKey | CVBNKOZIFFEKBY-GMMUVFOVSA-N |
| XLogP | 3.44 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|