C19H14N2 — CID 90976447
2-[3-(6-methyl-2-pyridinyl)phenyl]benzonitrile (PubChem CID 90976447) has the molecular formula C19H14N2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-[3-(6-methyl-2-pyridinyl)phenyl]benzonitrile.
| Compound Name | 2-[3-(6-methyl-2-pyridinyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 90976447 |
| Molecular Formula | C19H14N2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-[3-(6-methyl-2-pyridinyl)phenyl]benzonitrile |
| SMILES | Cc1cccc(-c2cccc(-c3ccccc3C#N)c2)n1 |
| InChI | InChI=1S/C19H14N2/c1-14-6-4-11-19(21-14)16-9-5-8-15(12-16)18-10-3-2-7-17(18)13-20/h2-12H,1H3 |
| InChIKey | MPERLCLSTNTXSE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |