C40H81N5O3 — CID 90984779
3-[3-[bis[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]amino]propyl-methylamino]-N-(2,2,4,4-tetramethylpentyl)propanamide (PubChem CID 90984779) has the molecular formula C40H81N5O3 and a molecular weight of 680.12 g/mol. Its IUPAC name is 3-[3-[bis[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]amino]propyl-methylamino]-N-(2,2,4,4-tetramethylpentyl)propanamide.
| Compound Name | 3-[3-[bis[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]amino]propyl-methylamino]-N-(2,2,4,4-tetramethylpentyl)propanamide |
|---|---|
| PubChem CID | 90984779 |
| Molecular Formula | C40H81N5O3 |
| Molecular Weight | 680.12 g/mol |
| Exact Mass | 679.63 |
| IUPAC Name | 3-[3-[bis[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]amino]propyl-methylamino]-N-(2,2,4,4-tetramethylpentyl)propanamide |
| SMILES | CN(CCCN(CCC(=O)NCC(C)(C)CC(C)(C)C)CCC(=O)NCC(C)(C)CC(C)(C)C)CCC(=O)NCC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C40H81N5O3/c1-35(2,3)26-38(10,11)29-41-32(46)18-23-44(16)21-17-22-45(24-19-33(47)42-30-39(12,13)27-36(4,5)6)25-20-34(48)43-31-40(14,15)28-37(7,8)9/h17-31H2,1-16H3,(H,41,46)(H,42,47)(H,43,48) |
| InChIKey | BSLGJOUFKUEXBZ-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.12 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |