C20H24FN5O2 — CID 90985438
7-(4-fluorophenyl)-5-N-(2-morpholin-4-ylethoxy)-7,8-dihydroquinazoline-2,5-diamine (PubChem CID 90985438) has the molecular formula C20H24FN5O2 and a molecular weight of 385.44 g/mol. Its IUPAC name is 7-(4-fluorophenyl)-5-N-(2-morpholin-4-ylethoxy)-7,8-dihydroquinazoline-2,5-diamine.
| Compound Name | 7-(4-fluorophenyl)-5-N-(2-morpholin-4-ylethoxy)-7,8-dihydroquinazoline-2,5-diamine |
|---|---|
| PubChem CID | 90985438 |
| Molecular Formula | C20H24FN5O2 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 7-(4-fluorophenyl)-5-N-(2-morpholin-4-ylethoxy)-7,8-dihydroquinazoline-2,5-diamine |
| SMILES | Nc1ncc2c(n1)CC(c1ccc(F)cc1)C=C2NOCCN1CCOCC1 |
| InChI | InChI=1S/C20H24FN5O2/c21-16-3-1-14(2-4-16)15-11-18-17(13-23-20(22)24-18)19(12-15)25-28-10-7-26-5-8-27-9-6-26/h1-4,12-13,15,25H,5-11H2,(H2,22,23,24) |
| InChIKey | RFDPUPXTWJMPNX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|