C16H18N4O — CID 91140524
5-N-methoxy-7-(4-methylphenyl)-7,8-dihydroquinazoline-2,5-diamine (PubChem CID 91140524) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 5-N-methoxy-7-(4-methylphenyl)-7,8-dihydroquinazoline-2,5-diamine.
| Compound Name | 5-N-methoxy-7-(4-methylphenyl)-7,8-dihydroquinazoline-2,5-diamine |
|---|---|
| PubChem CID | 91140524 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 5-N-methoxy-7-(4-methylphenyl)-7,8-dihydroquinazoline-2,5-diamine |
| SMILES | CONC1=CC(c2ccc(C)cc2)Cc2nc(N)ncc21 |
| InChI | InChI=1S/C16H18N4O/c1-10-3-5-11(6-4-10)12-7-14-13(9-18-16(17)19-14)15(8-12)20-21-2/h3-6,8-9,12,20H,7H2,1-2H3,(H2,17,18,19) |
| InChIKey | MTFNGDIQOUSRDM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|