C21H21NO3 — CID 90987559
11-(2-methoxyphenyl)-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-4,9,12-triene-10,12-diol (PubChem CID 90987559) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is 11-(2-methoxyphenyl)-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-4,9,12-triene-10,12-diol.
| Compound Name | 11-(2-methoxyphenyl)-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-4,9,12-triene-10,12-diol |
|---|---|
| PubChem CID | 90987559 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 11-(2-methoxyphenyl)-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-4,9,12-triene-10,12-diol |
| SMILES | COc1ccccc1-n1c(O)c2c(c1O)C1CC2C2C3C=CC(C3)C12 |
| InChI | InChI=1S/C21H21NO3/c1-25-15-5-3-2-4-14(15)22-20(23)18-12-9-13(19(18)21(22)24)17-11-7-6-10(8-11)16(12)17/h2-7,10-13,16-17,23-24H,8-9H2,1H3 |
| InChIKey | ZJJOIDAZKFTKBU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|