C20H18BrNO2 — CID 91210940
11-(4-bromophenyl)-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-4,9,12-triene-10,12-diol (PubChem CID 91210940) has the molecular formula C20H18BrNO2 and a molecular weight of 384.27 g/mol. Its IUPAC name is 11-(4-bromophenyl)-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-4,9,12-triene-10,12-diol.
| Compound Name | 11-(4-bromophenyl)-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-4,9,12-triene-10,12-diol |
|---|---|
| PubChem CID | 91210940 |
| Molecular Formula | C20H18BrNO2 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 11-(4-bromophenyl)-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-4,9,12-triene-10,12-diol |
| SMILES | Oc1c2c(c(O)n1-c1ccc(Br)cc1)C1CC2C2C3C=CC(C3)C12 |
| InChI | InChI=1S/C20H18BrNO2/c21-11-3-5-12(6-4-11)22-19(23)17-13-8-14(18(17)20(22)24)16-10-2-1-9(7-10)15(13)16/h1-6,9-10,13-16,23-24H,7-8H2 |
| InChIKey | YRJBJYAYAXCOCX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|