C21H12Br3N3O3 — CID 10746029
1,3,5-tris(4-bromophenyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 10746029) has the molecular formula C21H12Br3N3O3 and a molecular weight of 594.06 g/mol. Its IUPAC name is 1,3,5-tris(4-bromophenyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris(4-bromophenyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 10746029 |
| Molecular Formula | C21H12Br3N3O3 |
| Molecular Weight | 594.06 g/mol |
| Exact Mass | 590.84 |
| IUPAC Name | 1,3,5-tris(4-bromophenyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1n(-c2ccc(Br)cc2)c(=O)n(-c2ccc(Br)cc2)c(=O)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H12Br3N3O3/c22-13-1-7-16(8-2-13)25-19(28)26(17-9-3-14(23)4-10-17)21(30)27(20(25)29)18-11-5-15(24)6-12-18/h1-12H |
| InChIKey | DJLFNLQHDGJXHD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.06 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |