C13H12BrN3O2 — CID 57060156
2-(4-bromophenyl)-6-methyl-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione (PubChem CID 57060156) has the molecular formula C13H12BrN3O2 and a molecular weight of 322.16 g/mol. Its IUPAC name is 2-(4-bromophenyl)-6-methyl-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione.
| Compound Name | 2-(4-bromophenyl)-6-methyl-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione |
|---|---|
| PubChem CID | 57060156 |
| Molecular Formula | C13H12BrN3O2 |
| Molecular Weight | 322.16 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 2-(4-bromophenyl)-6-methyl-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione |
| SMILES | CC1=CCn2c(=O)n(-c3ccc(Br)cc3)c(=O)n2C1 |
| InChI | InChI=1S/C13H12BrN3O2/c1-9-6-7-15-12(18)17(13(19)16(15)8-9)11-4-2-10(14)3-5-11/h2-6H,7-8H2,1H3 |
| InChIKey | IBAJVZDPNISWHN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.16 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|