C28H26N4O6S2 — CID 90987946
N-[(2R)-1-[(6aS)-4-(2-nitrobenzoyl)-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-3-benzylsulfanyl-1-oxopropan-2-yl]thiophene-3-carboxamide (PubChem CID 90987946) has the molecular formula C28H26N4O6S2 and a molecular weight of 578.67 g/mol. Its IUPAC name is N-[(2R)-1-[(6aS)-4-(2-nitrobenzoyl)-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-3-benzylsulfanyl-1-oxopropan-2-yl]thiophene-3-carboxamide.
| Compound Name | N-[(2R)-1-[(6aS)-4-(2-nitrobenzoyl)-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-3-benzylsulfanyl-1-oxopropan-2-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 90987946 |
| Molecular Formula | C28H26N4O6S2 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.13 |
| IUPAC Name | N-[(2R)-1-[(6aS)-4-(2-nitrobenzoyl)-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-3-benzylsulfanyl-1-oxopropan-2-yl]thiophene-3-carboxamide |
| SMILES | O=C(N[C@@H](CSCc1ccccc1)C(=O)N1CCC2[C@H]1C(=O)CN2C(=O)c1ccccc1[N+](=O)[O-])c1ccsc1 |
| InChI | InChI=1S/C28H26N4O6S2/c33-24-14-31(27(35)20-8-4-5-9-22(20)32(37)38)23-10-12-30(25(23)24)28(36)21(29-26(34)19-11-13-39-16-19)17-40-15-18-6-2-1-3-7-18/h1-9,11,13,16,21,23,25H,10,12,14-15,17H2,(H,29,34)/t21-,23?,25-/m0/s1 |
| InChIKey | VCSQEOUEKQLDFO-HTWCLWFGSA-N |
| XLogP | 3.38 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|