C17H29N5O4 — CID 90997161
tert-butyl N-[3-amino-1-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2-methylpyrazol-3-yl)propylidene]carbamate (PubChem CID 90997161) has the molecular formula C17H29N5O4 and a molecular weight of 367.45 g/mol. Its IUPAC name is tert-butyl N-[3-amino-1-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2-methylpyrazol-3-yl)propylidene]carbamate.
| Compound Name | tert-butyl N-[3-amino-1-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2-methylpyrazol-3-yl)propylidene]carbamate |
|---|---|
| PubChem CID | 90997161 |
| Molecular Formula | C17H29N5O4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | tert-butyl N-[3-amino-1-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2-methylpyrazol-3-yl)propylidene]carbamate |
| SMILES | Cn1nccc1C(N)CC(=NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H29N5O4/c1-16(2,3)25-14(23)20-13(21-15(24)26-17(4,5)6)10-11(18)12-8-9-19-22(12)7/h8-9,11H,10,18H2,1-7H3,(H,20,21,23,24) |
| InChIKey | AXJLJMXQEKKRRD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 120.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|