C22H39N3O8 — CID 76679389
2,7-bis[(2-methylpropan-2-yl)oxycarbonylamino]-7-[(2-methylpropan-2-yl)oxycarbonylimino]heptanoic acid (PubChem CID 76679389) has the molecular formula C22H39N3O8 and a molecular weight of 473.57 g/mol. Its IUPAC name is 2,7-bis[(2-methylpropan-2-yl)oxycarbonylamino]-7-[(2-methylpropan-2-yl)oxycarbonylimino]heptanoic acid.
| Compound Name | 2,7-bis[(2-methylpropan-2-yl)oxycarbonylamino]-7-[(2-methylpropan-2-yl)oxycarbonylimino]heptanoic acid |
|---|---|
| PubChem CID | 76679389 |
| Molecular Formula | C22H39N3O8 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | 2,7-bis[(2-methylpropan-2-yl)oxycarbonylamino]-7-[(2-methylpropan-2-yl)oxycarbonylimino]heptanoic acid |
| SMILES | CC(C)(C)OC(=O)N=C(CCCCC(NC(=O)OC(C)(C)C)C(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H39N3O8/c1-20(2,3)31-17(28)23-14(16(26)27)12-10-11-13-15(24-18(29)32-21(4,5)6)25-19(30)33-22(7,8)9/h14H,10-13H2,1-9H3,(H,23,28)(H,26,27)(H,24,25,29,30) |
| InChIKey | GBTXVYRWJAOJPF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 152.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|